C19H23FN2O — CID 119527902
N-(2-amino-2-phenylethyl)-4-(2-fluorophenyl)-2-methylbutanamide (PubChem CID 119527902) has the molecular formula C19H23FN2O and a molecular weight of 314.40 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-4-(2-fluorophenyl)-2-methylbutanamide.
| Compound Name | N-(2-amino-2-phenylethyl)-4-(2-fluorophenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 119527902 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-4-(2-fluorophenyl)-2-methylbutanamide |
| SMILES | CC(CCc1ccccc1F)C(=O)NCC(N)c1ccccc1 |
| InChI | InChI=1S/C19H23FN2O/c1-14(11-12-15-7-5-6-10-17(15)20)19(23)22-13-18(21)16-8-3-2-4-9-16/h2-10,14,18H,11-13,21H2,1H3,(H,22,23) |
| InChIKey | NNXWZTMXYVVATO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |