C19H17F4NO3 — CID 122109904
2-[2-fluoro-4-[[2-methyl-2-[3-(trifluoromethyl)phenyl]propanoyl]amino]phenyl]acetic acid (PubChem CID 122109904) has the molecular formula C19H17F4NO3 and a molecular weight of 383.34 g/mol. Its IUPAC name is 2-[2-fluoro-4-[[2-methyl-2-[3-(trifluoromethyl)phenyl]propanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-4-[[2-methyl-2-[3-(trifluoromethyl)phenyl]propanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 122109904 |
| Molecular Formula | C19H17F4NO3 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[2-fluoro-4-[[2-methyl-2-[3-(trifluoromethyl)phenyl]propanoyl]amino]phenyl]acetic acid |
| SMILES | CC(C)(C(=O)Nc1ccc(CC(=O)O)c(F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F4NO3/c1-18(2,12-4-3-5-13(9-12)19(21,22)23)17(27)24-14-7-6-11(8-16(25)26)15(20)10-14/h3-7,9-10H,8H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | KAZSUGUUFHPGAH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |