C16H14ClNO3S — CID 122110269
5-[[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 122110269) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is 5-[[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 122110269 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 5-[[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)C2CC2c2ccccc2Cl)s1 |
| InChI | InChI=1S/C16H14ClNO3S/c17-13-4-2-1-3-10(13)11-7-12(11)15(19)18-8-9-5-6-14(22-9)16(20)21/h1-6,11-12H,7-8H2,(H,18,19)(H,20,21) |
| InChIKey | MWXVMZWZKTXABE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |