C18H21NO4S — CID 122110632
5-[[[4-(2-methoxyphenyl)-3-methylbutanoyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 122110632) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 5-[[[4-(2-methoxyphenyl)-3-methylbutanoyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[[4-(2-methoxyphenyl)-3-methylbutanoyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 122110632 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 5-[[[4-(2-methoxyphenyl)-3-methylbutanoyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | COc1ccccc1CC(C)CC(=O)NCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C18H21NO4S/c1-12(9-13-5-3-4-6-15(13)23-2)10-17(20)19-11-14-7-8-16(24-14)18(21)22/h3-8,12H,9-11H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | ZMRSYEFROQRYNQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |