C17H21BrFNO3 — CID 122113084
1-[3-(3-bromo-4-fluorophenyl)-2-methylpropanoyl]-6-methylpiperidine-3-carboxylic acid (PubChem CID 122113084) has the molecular formula C17H21BrFNO3 and a molecular weight of 386.26 g/mol. Its IUPAC name is 1-[3-(3-bromo-4-fluorophenyl)-2-methylpropanoyl]-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[3-(3-bromo-4-fluorophenyl)-2-methylpropanoyl]-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122113084 |
| Molecular Formula | C17H21BrFNO3 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 1-[3-(3-bromo-4-fluorophenyl)-2-methylpropanoyl]-6-methylpiperidine-3-carboxylic acid |
| SMILES | CC(Cc1ccc(F)c(Br)c1)C(=O)N1CC(C(=O)O)CCC1C |
| InChI | InChI=1S/C17H21BrFNO3/c1-10(7-12-4-6-15(19)14(18)8-12)16(21)20-9-13(17(22)23)5-3-11(20)2/h4,6,8,10-11,13H,3,5,7,9H2,1-2H3,(H,22,23) |
| InChIKey | WIZFNIOAEQLWMC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |