C16H19BrFNO3 — CID 124692592
(3S)-1-[(2R)-3-(3-bromo-4-fluorophenyl)-2-methylpropanoyl]piperidine-3-carboxylic acid (PubChem CID 124692592) has the molecular formula C16H19BrFNO3 and a molecular weight of 372.23 g/mol. Its IUPAC name is (3S)-1-[(2R)-3-(3-bromo-4-fluorophenyl)-2-methylpropanoyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[(2R)-3-(3-bromo-4-fluorophenyl)-2-methylpropanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124692592 |
| Molecular Formula | C16H19BrFNO3 |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | (3S)-1-[(2R)-3-(3-bromo-4-fluorophenyl)-2-methylpropanoyl]piperidine-3-carboxylic acid |
| SMILES | C[C@H](Cc1ccc(F)c(Br)c1)C(=O)N1CCC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C16H19BrFNO3/c1-10(7-11-4-5-14(18)13(17)8-11)15(20)19-6-2-3-12(9-19)16(21)22/h4-5,8,10,12H,2-3,6-7,9H2,1H3,(H,21,22)/t10-,12+/m1/s1 |
| InChIKey | OMMUIMIKFGYIPR-PWSUYJOCSA-N |
| XLogP | 3.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |