C20H30N2O3 — CID 122113197
1-[4-[[ethyl(propyl)amino]methyl]benzoyl]-6-methylpiperidine-3-carboxylic acid (PubChem CID 122113197) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[4-[[ethyl(propyl)amino]methyl]benzoyl]-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[4-[[ethyl(propyl)amino]methyl]benzoyl]-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122113197 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[4-[[ethyl(propyl)amino]methyl]benzoyl]-6-methylpiperidine-3-carboxylic acid |
| SMILES | CCCN(CC)Cc1ccc(C(=O)N2CC(C(=O)O)CCC2C)cc1 |
| InChI | InChI=1S/C20H30N2O3/c1-4-12-21(5-2)13-16-7-10-17(11-8-16)19(23)22-14-18(20(24)25)9-6-15(22)3/h7-8,10-11,15,18H,4-6,9,12-14H2,1-3H3,(H,24,25) |
| InChIKey | AXGYDJOFXXHPCV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |