C13H17NO — CID 22282369
(2-methylaziridin-1-yl)-(4-propylphenyl)methanone (PubChem CID 22282369) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (2-methylaziridin-1-yl)-(4-propylphenyl)methanone.
| Compound Name | (2-methylaziridin-1-yl)-(4-propylphenyl)methanone |
|---|---|
| PubChem CID | 22282369 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (2-methylaziridin-1-yl)-(4-propylphenyl)methanone |
| SMILES | CCCc1ccc(C(=O)N2CC2C)cc1 |
| InChI | InChI=1S/C13H17NO/c1-3-4-11-5-7-12(8-6-11)13(15)14-9-10(14)2/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | WRMUPKPSIQPEDY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|