C18H27NO3S — CID 97427224
[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-(4-propylphenyl)methanone (PubChem CID 97427224) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is [(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-(4-propylphenyl)methanone.
| Compound Name | [(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-(4-propylphenyl)methanone |
|---|---|
| PubChem CID | 97427224 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-(4-propylphenyl)methanone |
| SMILES | CCCc1ccc(C(=O)N2CC[C@H](S(=O)(=O)C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C18H27NO3S/c1-5-6-14-7-9-15(10-8-14)17(20)19-12-11-16(13-19)23(21,22)18(2,3)4/h7-10,16H,5-6,11-13H2,1-4H3/t16-/m0/s1 |
| InChIKey | HMHVWRDESWXKES-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |