C22H27NO4S — CID 90591711
[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-(4-propylphenyl)methanone (PubChem CID 90591711) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-(4-propylphenyl)methanone.
| Compound Name | [4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-(4-propylphenyl)methanone |
|---|---|
| PubChem CID | 90591711 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-(4-propylphenyl)methanone |
| SMILES | CCCc1ccc(C(=O)N2CCC(S(=O)(=O)c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-3-4-17-5-7-18(8-6-17)22(24)23-15-13-21(14-16-23)28(25,26)20-11-9-19(27-2)10-12-20/h5-12,21H,3-4,13-16H2,1-2H3 |
| InChIKey | NTRIXQBWBZNLRU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |