C18H24N2O4 — CID 122113487
6-methyl-1-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)piperidine-3-carboxylic acid (PubChem CID 122113487) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 6-methyl-1-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 6-methyl-1-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122113487 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 6-methyl-1-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)piperidine-3-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)CN1C(=O)c1cc2c([nH]c1=O)CCCCC2 |
| InChI | InChI=1S/C18H24N2O4/c1-11-7-8-13(18(23)24)10-20(11)17(22)14-9-12-5-3-2-4-6-15(12)19-16(14)21/h9,11,13H,2-8,10H2,1H3,(H,19,21)(H,23,24) |
| InChIKey | DINLHWYCJHNTQN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |