C19H25N3O3S — CID 136526904
N-cyclopropyl-N-methyl-3-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 136526904) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-cyclopropyl-N-methyl-3-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-cyclopropyl-N-methyl-3-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 136526904 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-cyclopropyl-N-methyl-3-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CN(C(=O)C1CSCN1C(=O)c1cc2c([nH]c1=O)CCCCC2)C1CC1 |
| InChI | InChI=1S/C19H25N3O3S/c1-21(13-7-8-13)19(25)16-10-26-11-22(16)18(24)14-9-12-5-3-2-4-6-15(12)20-17(14)23/h9,13,16H,2-8,10-11H2,1H3,(H,20,23) |
| InChIKey | NRFKAIUTCPNPFH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |