C15H15ClF3NO3 — CID 122117410
1-[3-chloro-5-(trifluoromethyl)benzoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122117410) has the molecular formula C15H15ClF3NO3 and a molecular weight of 349.74 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)benzoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)benzoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122117410 |
| Molecular Formula | C15H15ClF3NO3 |
| Molecular Weight | 349.74 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)benzoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)c2cc(Cl)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H15ClF3NO3/c1-8-2-10(14(22)23)7-20(6-8)13(21)9-3-11(15(17,18)19)5-12(16)4-9/h3-5,8,10H,2,6-7H2,1H3,(H,22,23) |
| InChIKey | YPZXKJZLJUOAPI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |