C21H27N3O4 — CID 122118295
5-methyl-1-[4-(2-methylpropoxy)-1-phenylpyrazole-3-carbonyl]piperidine-3-carboxylic acid (PubChem CID 122118295) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-methyl-1-[4-(2-methylpropoxy)-1-phenylpyrazole-3-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[4-(2-methylpropoxy)-1-phenylpyrazole-3-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122118295 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 5-methyl-1-[4-(2-methylpropoxy)-1-phenylpyrazole-3-carbonyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)COc1cn(-c2ccccc2)nc1C(=O)N1CC(C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C21H27N3O4/c1-14(2)13-28-18-12-24(17-7-5-4-6-8-17)22-19(18)20(25)23-10-15(3)9-16(11-23)21(26)27/h4-8,12,14-16H,9-11,13H2,1-3H3,(H,26,27) |
| InChIKey | PGPMHDHHFAOTNV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |