C20H22N2O4S — CID 122118715
5-methyl-1-[4-[(thiophene-2-carbonylamino)methyl]benzoyl]piperidine-3-carboxylic acid (PubChem CID 122118715) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 5-methyl-1-[4-[(thiophene-2-carbonylamino)methyl]benzoyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[4-[(thiophene-2-carbonylamino)methyl]benzoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122118715 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 5-methyl-1-[4-[(thiophene-2-carbonylamino)methyl]benzoyl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)c2ccc(CNC(=O)c3cccs3)cc2)C1 |
| InChI | InChI=1S/C20H22N2O4S/c1-13-9-16(20(25)26)12-22(11-13)19(24)15-6-4-14(5-7-15)10-21-18(23)17-3-2-8-27-17/h2-8,13,16H,9-12H2,1H3,(H,21,23)(H,25,26) |
| InChIKey | HGGSMQYDTZHRRA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |