C22H27N3O4S — CID 46492559
tert-butyl 4-[4-[(thiophene-2-carbonylamino)methyl]benzoyl]piperazine-1-carboxylate (PubChem CID 46492559) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is tert-butyl 4-[4-[(thiophene-2-carbonylamino)methyl]benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(thiophene-2-carbonylamino)methyl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46492559 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | tert-butyl 4-[4-[(thiophene-2-carbonylamino)methyl]benzoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2ccc(CNC(=O)c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C22H27N3O4S/c1-22(2,3)29-21(28)25-12-10-24(11-13-25)20(27)17-8-6-16(7-9-17)15-23-19(26)18-5-4-14-30-18/h4-9,14H,10-13,15H2,1-3H3,(H,23,26) |
| InChIKey | CBLCXZGBRYAUQI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |