C18H25ClN2O4 — CID 122123285
1-[2-(5-chloro-2-ethoxyphenyl)ethylcarbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122123285) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-ethoxyphenyl)ethylcarbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-(5-chloro-2-ethoxyphenyl)ethylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122123285 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-[2-(5-chloro-2-ethoxyphenyl)ethylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CCOc1ccc(Cl)cc1CCNC(=O)N1CC(C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-3-25-16-5-4-15(19)9-13(16)6-7-20-18(24)21-10-12(2)8-14(11-21)17(22)23/h4-5,9,12,14H,3,6-8,10-11H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | MHVSPLGEQWLVIO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |