C19H24ClN3O3 — CID 122123542
1-[2-(6-chloro-1-methylindol-3-yl)ethylcarbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122123542) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 1-[2-(6-chloro-1-methylindol-3-yl)ethylcarbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-(6-chloro-1-methylindol-3-yl)ethylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122123542 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-[2-(6-chloro-1-methylindol-3-yl)ethylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)NCCc2cn(C)c3cc(Cl)ccc23)C1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-12-7-14(18(24)25)11-23(9-12)19(26)21-6-5-13-10-22(2)17-8-15(20)3-4-16(13)17/h3-4,8,10,12,14H,5-7,9,11H2,1-2H3,(H,21,26)(H,24,25) |
| InChIKey | PEXKWTAGWQSYQG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |