C17H26N2O5 — CID 122123432
1-[[1-(furan-2-yl)-4-methoxybutan-2-yl]carbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122123432) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is 1-[[1-(furan-2-yl)-4-methoxybutan-2-yl]carbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[[1-(furan-2-yl)-4-methoxybutan-2-yl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122123432 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-[[1-(furan-2-yl)-4-methoxybutan-2-yl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | COCCC(Cc1ccco1)NC(=O)N1CC(C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C17H26N2O5/c1-12-8-13(16(20)21)11-19(10-12)17(22)18-14(5-7-23-2)9-15-4-3-6-24-15/h3-4,6,12-14H,5,7-11H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | ZSIYHLWZMCDBPG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |