C22H29NO3 — CID 122124471
1-[[5-(4-tert-butylphenyl)furan-2-yl]methyl]-6-methylpiperidine-3-carboxylic acid (PubChem CID 122124471) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-[[5-(4-tert-butylphenyl)furan-2-yl]methyl]-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[[5-(4-tert-butylphenyl)furan-2-yl]methyl]-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122124471 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1-[[5-(4-tert-butylphenyl)furan-2-yl]methyl]-6-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)CN1Cc1ccc(-c2ccc(C(C)(C)C)cc2)o1 |
| InChI | InChI=1S/C22H29NO3/c1-15-5-6-17(21(24)25)13-23(15)14-19-11-12-20(26-19)16-7-9-18(10-8-16)22(2,3)4/h7-12,15,17H,5-6,13-14H2,1-4H3,(H,24,25) |
| InChIKey | PDHYUFSPNBXWKC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |