C18H20N2O5 — CID 122124427
6-methyl-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidine-3-carboxylic acid (PubChem CID 122124427) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 6-methyl-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 6-methyl-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122124427 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 6-methyl-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidine-3-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)CN1Cc1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H20N2O5/c1-12-6-7-13(18(21)22)10-19(12)11-14-8-9-17(25-14)15-4-2-3-5-16(15)20(23)24/h2-5,8-9,12-13H,6-7,10-11H2,1H3,(H,21,22) |
| InChIKey | SBGVHGKIFXIBSN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|