C16H18N2O4 — CID 7443091
(3S)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidin-3-ol (PubChem CID 7443091) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (3S)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidin-3-ol.
| Compound Name | (3S)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 7443091 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3S)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidin-3-ol |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc(CN2CCC[C@H](O)C2)o1 |
| InChI | InChI=1S/C16H18N2O4/c19-12-4-3-9-17(10-12)11-13-7-8-16(22-13)14-5-1-2-6-15(14)18(20)21/h1-2,5-8,12,19H,3-4,9-11H2/t12-/m0/s1 |
| InChIKey | SMDREIUPALVXIS-LBPRGKRZSA-N |
| XLogP | 2.81 |
| TPSA | 79.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|