C11H18N6 — CID 122125841
1-methyl-N-[(1-prop-2-enyltriazol-4-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine (PubChem CID 122125841) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is 1-methyl-N-[(1-prop-2-enyltriazol-4-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine.
| Compound Name | 1-methyl-N-[(1-prop-2-enyltriazol-4-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 122125841 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1-methyl-N-[(1-prop-2-enyltriazol-4-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine |
| SMILES | C=CCn1cc(CNC2=NCCCN2C)nn1 |
| InChI | InChI=1S/C11H18N6/c1-3-6-17-9-10(14-15-17)8-13-11-12-5-4-7-16(11)2/h3,9H,1,4-8H2,2H3,(H,12,13) |
| InChIKey | AVOUIRMKVRADSW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|