C14H20IN3 — CID 122125966
1-(3,5-dimethylphenyl)-2-spiro[2.2]pentan-2-ylguanidine;hydroiodide (PubChem CID 122125966) has the molecular formula C14H20IN3 and a molecular weight of 357.24 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-spiro[2.2]pentan-2-ylguanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-spiro[2.2]pentan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 122125966 |
| Molecular Formula | C14H20IN3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-spiro[2.2]pentan-2-ylguanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/C2CC23CC3)c1.I |
| InChI | InChI=1S/C14H19N3.HI/c1-9-5-10(2)7-11(6-9)16-13(15)17-12-8-14(12)3-4-14;/h5-7,12H,3-4,8H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | WYJCHFXHKNCSBL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|