C15H28N4O4 — CID 122126635
2-[[[3-[(carbamoylamino)methyl]piperidine-1-carbonyl]amino]methyl]-4-methylpentanoic acid (PubChem CID 122126635) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[[[3-[(carbamoylamino)methyl]piperidine-1-carbonyl]amino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[3-[(carbamoylamino)methyl]piperidine-1-carbonyl]amino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122126635 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 2-[[[3-[(carbamoylamino)methyl]piperidine-1-carbonyl]amino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNC(=O)N1CCCC(CNC(N)=O)C1)C(=O)O |
| InChI | InChI=1S/C15H28N4O4/c1-10(2)6-12(13(20)21)8-18-15(23)19-5-3-4-11(9-19)7-17-14(16)22/h10-12H,3-9H2,1-2H3,(H,18,23)(H,20,21)(H3,16,17,22) |
| InChIKey | NCUHNYYPORDFAQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |