C12H24N4O2 — CID 79013238
[1-[(2R)-2-amino-3-methylbutanoyl]piperidin-3-yl]methylurea (PubChem CID 79013238) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is [1-[(2R)-2-amino-3-methylbutanoyl]piperidin-3-yl]methylurea.
| Compound Name | [1-[(2R)-2-amino-3-methylbutanoyl]piperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 79013238 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | [1-[(2R)-2-amino-3-methylbutanoyl]piperidin-3-yl]methylurea |
| SMILES | CC(C)[C@@H](N)C(=O)N1CCCC(CNC(N)=O)C1 |
| InChI | InChI=1S/C12H24N4O2/c1-8(2)10(13)11(17)16-5-3-4-9(7-16)6-15-12(14)18/h8-10H,3-7,13H2,1-2H3,(H3,14,15,18)/t9?,10-/m1/s1 |
| InChIKey | FNVSWIJNFQZWCU-QVDQXJPCSA-N |
| XLogP | -0.12 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |