C17H19F3N2O2S — CID 122126973
2,2-dimethyl-4-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylamino]butanoic acid (PubChem CID 122126973) has the molecular formula C17H19F3N2O2S and a molecular weight of 372.41 g/mol. Its IUPAC name is 2,2-dimethyl-4-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylamino]butanoic acid.
| Compound Name | 2,2-dimethyl-4-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 122126973 |
| Molecular Formula | C17H19F3N2O2S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2,2-dimethyl-4-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylamino]butanoic acid |
| SMILES | CC(C)(CCNCc1csc(-c2ccc(C(F)(F)F)cc2)n1)C(=O)O |
| InChI | InChI=1S/C17H19F3N2O2S/c1-16(2,15(23)24)7-8-21-9-13-10-25-14(22-13)11-3-5-12(6-4-11)17(18,19)20/h3-6,10,21H,7-9H2,1-2H3,(H,23,24) |
| InChIKey | YMRAMEHCNIPQRK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|