C18H21F3N2O2S — CID 99796613
7-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylamino]heptanoic acid (PubChem CID 99796613) has the molecular formula C18H21F3N2O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is 7-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylamino]heptanoic acid.
| Compound Name | 7-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylamino]heptanoic acid |
|---|---|
| PubChem CID | 99796613 |
| Molecular Formula | C18H21F3N2O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 7-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylamino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNCc1csc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C18H21F3N2O2S/c19-18(20,21)14-8-6-13(7-9-14)17-23-15(12-26-17)11-22-10-4-2-1-3-5-16(24)25/h6-9,12,22H,1-5,10-11H2,(H,24,25) |
| InChIKey | YNYNYVXLMKICLL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|