C20H25NO2 — CID 122127079
2,2-dimethyl-4-[[3-(4-methylphenyl)phenyl]methylamino]butanoic acid (PubChem CID 122127079) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2,2-dimethyl-4-[[3-(4-methylphenyl)phenyl]methylamino]butanoic acid.
| Compound Name | 2,2-dimethyl-4-[[3-(4-methylphenyl)phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 122127079 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2,2-dimethyl-4-[[3-(4-methylphenyl)phenyl]methylamino]butanoic acid |
| SMILES | Cc1ccc(-c2cccc(CNCCC(C)(C)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H25NO2/c1-15-7-9-17(10-8-15)18-6-4-5-16(13-18)14-21-12-11-20(2,3)19(22)23/h4-10,13,21H,11-12,14H2,1-3H3,(H,22,23) |
| InChIKey | GFMOUHVAPYIKQX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|