C20H23ClN2O3 — CID 122126812
4-[[3-[(4-chlorobenzoyl)amino]phenyl]methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122126812) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is 4-[[3-[(4-chlorobenzoyl)amino]phenyl]methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[[3-[(4-chlorobenzoyl)amino]phenyl]methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122126812 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-[[3-[(4-chlorobenzoyl)amino]phenyl]methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCc1cccc(NC(=O)c2ccc(Cl)cc2)c1)C(=O)O |
| InChI | InChI=1S/C20H23ClN2O3/c1-20(2,19(25)26)10-11-22-13-14-4-3-5-17(12-14)23-18(24)15-6-8-16(21)9-7-15/h3-9,12,22H,10-11,13H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | DWUPKIKXSLEWIS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|