C26H29N3O2 — CID 143752591
3-acetyl-N-[3-[[3-(benzylamino)phenyl]methylamino]propyl]benzamide (PubChem CID 143752591) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-acetyl-N-[3-[[3-(benzylamino)phenyl]methylamino]propyl]benzamide.
| Compound Name | 3-acetyl-N-[3-[[3-(benzylamino)phenyl]methylamino]propyl]benzamide |
|---|---|
| PubChem CID | 143752591 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-acetyl-N-[3-[[3-(benzylamino)phenyl]methylamino]propyl]benzamide |
| SMILES | CC(=O)c1cccc(C(=O)NCCCNCc2cccc(NCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H29N3O2/c1-20(30)23-11-6-12-24(17-23)26(31)28-15-7-14-27-18-22-10-5-13-25(16-22)29-19-21-8-3-2-4-9-21/h2-6,8-13,16-17,27,29H,7,14-15,18-19H2,1H3,(H,28,31) |
| InChIKey | ZLSLIKRFZSAQDI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|