C18H29NO2 — CID 122127415
4-[2-(4-tert-butylphenyl)ethylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127415) has the molecular formula C18H29NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is 4-[2-(4-tert-butylphenyl)ethylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[2-(4-tert-butylphenyl)ethylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127415 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 4-[2-(4-tert-butylphenyl)ethylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCCc1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C18H29NO2/c1-17(2,3)15-8-6-14(7-9-15)10-12-19-13-11-18(4,5)16(20)21/h6-9,19H,10-13H2,1-5H3,(H,20,21) |
| InChIKey | NZFSBEDMHWIWIA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|