C20H33NO2 — CID 23431223
3-[4-[2-(heptylamino)ethyl]phenyl]-2,2-dimethylpropanoic acid (PubChem CID 23431223) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 3-[4-[2-(heptylamino)ethyl]phenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-[2-(heptylamino)ethyl]phenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 23431223 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 3-[4-[2-(heptylamino)ethyl]phenyl]-2,2-dimethylpropanoic acid |
| SMILES | CCCCCCCNCCc1ccc(CC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C20H33NO2/c1-4-5-6-7-8-14-21-15-13-17-9-11-18(12-10-17)16-20(2,3)19(22)23/h9-12,21H,4-8,13-16H2,1-3H3,(H,22,23) |
| InChIKey | SFDHLLZYOWUZJX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|