C17H32N2O4 — CID 122127900
2-[[[1-(4-methoxy-4-oxobutyl)piperidin-4-yl]amino]methyl]-4-methylpentanoic acid (PubChem CID 122127900) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-[[[1-(4-methoxy-4-oxobutyl)piperidin-4-yl]amino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[1-(4-methoxy-4-oxobutyl)piperidin-4-yl]amino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122127900 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 2-[[[1-(4-methoxy-4-oxobutyl)piperidin-4-yl]amino]methyl]-4-methylpentanoic acid |
| SMILES | COC(=O)CCCN1CCC(NCC(CC(C)C)C(=O)O)CC1 |
| InChI | InChI=1S/C17H32N2O4/c1-13(2)11-14(17(21)22)12-18-15-6-9-19(10-7-15)8-4-5-16(20)23-3/h13-15,18H,4-12H2,1-3H3,(H,21,22) |
| InChIKey | QZISIMDIBGQVSO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |