C18H35NO2 — CID 122127731
4-methyl-2-[[[4-(2-methylbutan-2-yl)cyclohexyl]amino]methyl]pentanoic acid (PubChem CID 122127731) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is 4-methyl-2-[[[4-(2-methylbutan-2-yl)cyclohexyl]amino]methyl]pentanoic acid.
| Compound Name | 4-methyl-2-[[[4-(2-methylbutan-2-yl)cyclohexyl]amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 122127731 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | 4-methyl-2-[[[4-(2-methylbutan-2-yl)cyclohexyl]amino]methyl]pentanoic acid |
| SMILES | CCC(C)(C)C1CCC(NCC(CC(C)C)C(=O)O)CC1 |
| InChI | InChI=1S/C18H35NO2/c1-6-18(4,5)15-7-9-16(10-8-15)19-12-14(17(20)21)11-13(2)3/h13-16,19H,6-12H2,1-5H3,(H,20,21) |
| InChIKey | YXRRLCNUOBESOW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |