C18H22F3N3O2 — CID 122128328
2-ethyl-2-[[[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methylamino]methyl]butanoic acid (PubChem CID 122128328) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-ethyl-2-[[[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methylamino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 122128328 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-ethyl-2-[[[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methylamino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNCc1cnn(-c2ccc(C(F)(F)F)cc2)c1)C(=O)O |
| InChI | InChI=1S/C18H22F3N3O2/c1-3-17(4-2,16(25)26)12-22-9-13-10-23-24(11-13)15-7-5-14(6-8-15)18(19,20)21/h5-8,10-11,22H,3-4,9,12H2,1-2H3,(H,25,26) |
| InChIKey | ZHNYOMUKIXNLFX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |