C13H20FNO3 — CID 122129354
2-[1-[(3-fluorocyclohexanecarbonyl)amino]cyclobutyl]acetic acid (PubChem CID 122129354) has the molecular formula C13H20FNO3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-[1-[(3-fluorocyclohexanecarbonyl)amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(3-fluorocyclohexanecarbonyl)amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 122129354 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-[1-[(3-fluorocyclohexanecarbonyl)amino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)C2CCCC(F)C2)CCC1 |
| InChI | InChI=1S/C13H20FNO3/c14-10-4-1-3-9(7-10)12(18)15-13(5-2-6-13)8-11(16)17/h9-10H,1-8H2,(H,15,18)(H,16,17) |
| InChIKey | XLUGQIKVSOFBHO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |