C12H19NO3 — CID 122129367
1-[(2-methylcyclohexanecarbonyl)amino]cyclopropane-1-carboxylic acid (PubChem CID 122129367) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-[(2-methylcyclohexanecarbonyl)amino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(2-methylcyclohexanecarbonyl)amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 122129367 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 1-[(2-methylcyclohexanecarbonyl)amino]cyclopropane-1-carboxylic acid |
| SMILES | CC1CCCCC1C(=O)NC1(C(=O)O)CC1 |
| InChI | InChI=1S/C12H19NO3/c1-8-4-2-3-5-9(8)10(14)13-12(6-7-12)11(15)16/h8-9H,2-7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | ULLQIWXBJLIQJC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |