About 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride
2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride (PubChem CID 122129766) has the molecular formula C7H9ClN4
and a molecular weight of 184.63 g/mol. Its IUPAC name is 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride.
Analyze 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride?
The IUPAC name of 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride (CID 122129766) is 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride.
What is the SMILES notation for 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride?
The canonical SMILES for 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride is Cc1nc2cccnn2c1N.Cl.
What is the InChIKey of 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride?
The InChIKey is LVZNYPTUKGSIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.ClH/c1-5-7(8)11-6(10-5)3-2-4-9-11;/h2-4H,8H2,1H3;1H.
What are the key properties of 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride?
2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride has a molecular weight of 184.63 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[1,2-b]pyridazin-3-amine;hydrochloride is sourced from PubChem (CID 122129766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).