C16H26N4OS — CID 122130985
3-(2-ethylimidazol-1-yl)-N-(thiolan-3-ylmethyl)piperidine-1-carboxamide (PubChem CID 122130985) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is 3-(2-ethylimidazol-1-yl)-N-(thiolan-3-ylmethyl)piperidine-1-carboxamide.
| Compound Name | 3-(2-ethylimidazol-1-yl)-N-(thiolan-3-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122130985 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-(2-ethylimidazol-1-yl)-N-(thiolan-3-ylmethyl)piperidine-1-carboxamide |
| SMILES | CCc1nccn1C1CCCN(C(=O)NCC2CCSC2)C1 |
| InChI | InChI=1S/C16H26N4OS/c1-2-15-17-6-8-20(15)14-4-3-7-19(11-14)16(21)18-10-13-5-9-22-12-13/h6,8,13-14H,2-5,7,9-12H2,1H3,(H,18,21) |
| InChIKey | SHMOZLBRMSPEBF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |