C17H17ClN2O3 — CID 122132710
2-chloro-5-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-N,N-dimethylbenzamide (PubChem CID 122132710) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is 2-chloro-5-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 2-chloro-5-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 122132710 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-chloro-5-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(NC(=O)[C@H](O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C17H17ClN2O3/c1-20(2)17(23)13-10-12(8-9-14(13)18)19-16(22)15(21)11-6-4-3-5-7-11/h3-10,15,21H,1-2H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | MGSPDUSXUGVZJE-OAHLLOKOSA-N |
| XLogP | 2.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |