C18H20N4O — CID 122133317
3-methyl-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]quinazolin-4-one (PubChem CID 122133317) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-methyl-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]quinazolin-4-one.
| Compound Name | 3-methyl-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 122133317 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-methyl-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]quinazolin-4-one |
| SMILES | CN(CCc1ccccn1)Cc1nc2ccccc2c(=O)n1C |
| InChI | InChI=1S/C18H20N4O/c1-21(12-10-14-7-5-6-11-19-14)13-17-20-16-9-4-3-8-15(16)18(23)22(17)2/h3-9,11H,10,12-13H2,1-2H3 |
| InChIKey | NEHLJMJOESLYHP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |