C18H17N3O3 — CID 43021661
pyridin-2-ylmethyl 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate (PubChem CID 43021661) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is pyridin-2-ylmethyl 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate.
| Compound Name | pyridin-2-ylmethyl 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 43021661 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | pyridin-2-ylmethyl 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate |
| SMILES | Cn1c(CCC(=O)OCc2ccccn2)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H17N3O3/c1-21-16(20-15-8-3-2-7-14(15)18(21)23)9-10-17(22)24-12-13-6-4-5-11-19-13/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | OFBZYSFOKFIRAT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |