C16H16ClNO2 — CID 122133355
2-(3-chlorophenyl)-N-(3-hydroxy-2,4-dimethylphenyl)acetamide (PubChem CID 122133355) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(3-hydroxy-2,4-dimethylphenyl)acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-(3-hydroxy-2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 122133355 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(3-hydroxy-2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2cccc(Cl)c2)c(C)c1O |
| InChI | InChI=1S/C16H16ClNO2/c1-10-6-7-14(11(2)16(10)20)18-15(19)9-12-4-3-5-13(17)8-12/h3-8,20H,9H2,1-2H3,(H,18,19) |
| InChIKey | OXORWMPCIDYHQL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |