C16H17ClN2O — CID 53384824
2-(3-chlorophenyl)-N-[2-(dimethylamino)phenyl]acetamide (PubChem CID 53384824) has the molecular formula C16H17ClN2O and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[2-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-[2-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 53384824 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[2-(dimethylamino)phenyl]acetamide |
| SMILES | CN(C)c1ccccc1NC(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2O/c1-19(2)15-9-4-3-8-14(15)18-16(20)11-12-6-5-7-13(17)10-12/h3-10H,11H2,1-2H3,(H,18,20) |
| InChIKey | ZMGXDQCEPADWPM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |