C18H24N4O3 — CID 122134451
tert-butyl 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoylamino]benzoate (PubChem CID 122134451) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is tert-butyl 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoylamino]benzoate.
| Compound Name | tert-butyl 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 122134451 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | tert-butyl 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoylamino]benzoate |
| SMILES | Cc1c(CNC(=O)Nc2ccccc2C(=O)OC(C)(C)C)cnn1C |
| InChI | InChI=1S/C18H24N4O3/c1-12-13(11-20-22(12)5)10-19-17(24)21-15-9-7-6-8-14(15)16(23)25-18(2,3)4/h6-9,11H,10H2,1-5H3,(H2,19,21,24) |
| InChIKey | OVOALTSQRQDPFX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |