C17H29N3O3 — CID 126835673
tert-butyl 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoyl]-2-ethylbutanoate (PubChem CID 126835673) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoyl]-2-ethylbutanoate.
| Compound Name | tert-butyl 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoyl]-2-ethylbutanoate |
|---|---|
| PubChem CID | 126835673 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | tert-butyl 2-[(1,5-dimethylpyrazol-4-yl)methylcarbamoyl]-2-ethylbutanoate |
| SMILES | CCC(CC)(C(=O)NCc1cnn(C)c1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29N3O3/c1-8-17(9-2,15(22)23-16(4,5)6)14(21)18-10-13-11-19-20(7)12(13)3/h11H,8-10H2,1-7H3,(H,18,21) |
| InChIKey | ZWPOEZZMBKTBCH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|