C14H20F3N5O2 — CID 122136045
2,5-dimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]morpholine-4-carboxamide (PubChem CID 122136045) has the molecular formula C14H20F3N5O2 and a molecular weight of 347.34 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]morpholine-4-carboxamide.
| Compound Name | 2,5-dimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 122136045 |
| Molecular Formula | C14H20F3N5O2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2,5-dimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]morpholine-4-carboxamide |
| SMILES | CC1CN(C(=O)NCCNc2nccc(C(F)(F)F)n2)C(C)CO1 |
| InChI | InChI=1S/C14H20F3N5O2/c1-9-8-24-10(2)7-22(9)13(23)20-6-5-19-12-18-4-3-11(21-12)14(15,16)17/h3-4,9-10H,5-8H2,1-2H3,(H,20,23)(H,18,19,21) |
| InChIKey | ICZPJOPCPKMETD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|