C16H28N4O2S — CID 122137381
N-(2-tert-butylsulfinylethyl)-3-(4-methylpyrazol-1-yl)piperidine-1-carboxamide (PubChem CID 122137381) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-(2-tert-butylsulfinylethyl)-3-(4-methylpyrazol-1-yl)piperidine-1-carboxamide.
| Compound Name | N-(2-tert-butylsulfinylethyl)-3-(4-methylpyrazol-1-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122137381 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-(2-tert-butylsulfinylethyl)-3-(4-methylpyrazol-1-yl)piperidine-1-carboxamide |
| SMILES | Cc1cnn(C2CCCN(C(=O)NCCS(=O)C(C)(C)C)C2)c1 |
| InChI | InChI=1S/C16H28N4O2S/c1-13-10-18-20(11-13)14-6-5-8-19(12-14)15(21)17-7-9-23(22)16(2,3)4/h10-11,14H,5-9,12H2,1-4H3,(H,17,21) |
| InChIKey | ZVBKEQBLDJYWQJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |