C19H18N2O4 — CID 122139777
(4aR,7aS)-6-benzyl-1-(furan-3-carbonyl)-3,4,4a,7a-tetrahydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 122139777) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (4aR,7aS)-6-benzyl-1-(furan-3-carbonyl)-3,4,4a,7a-tetrahydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | (4aR,7aS)-6-benzyl-1-(furan-3-carbonyl)-3,4,4a,7a-tetrahydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 122139777 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (4aR,7aS)-6-benzyl-1-(furan-3-carbonyl)-3,4,4a,7a-tetrahydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1[C@@H]2[C@@H](CCCN2C(=O)c2ccoc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O4/c22-17(14-8-10-25-12-14)20-9-4-7-15-16(20)19(24)21(18(15)23)11-13-5-2-1-3-6-13/h1-3,5-6,8,10,12,15-16H,4,7,9,11H2/t15-,16+/m1/s1 |
| InChIKey | VKFCKAPLTFZIJA-CVEARBPZSA-N |
| XLogP | 2.07 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|